About 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole
3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole (PubChem CID 143610074) has the molecular formula C9H12FN3
and a molecular weight of 181.21 g/mol. Its IUPAC name is 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole |
| PubChem CID | 143610074 |
| Molecular Formula | C9H12FN3 |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole |
| SMILES | CC1=CNNN1C1=CCCC=C1F |
| InChI | InChI=1S/C9H12FN3/c1-7-6-11-12-13(7)9-5-3-2-4-8(9)10/h4-6,11-12H,2-3H2,1H3 |
| InChIKey | CBGMACPVRPDLBN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole?
The IUPAC name of 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole (CID 143610074) is 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole.
What is the SMILES notation for 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole?
The canonical SMILES for 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole is CC1=CNNN1C1=CCCC=C1F.
What is the InChIKey of 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole?
The InChIKey is CBGMACPVRPDLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12FN3/c1-7-6-11-12-13(7)9-5-3-2-4-8(9)10/h4-6,11-12H,2-3H2,1H3.
What are the key properties of 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole?
3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole has a molecular weight of 181.21 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-fluorocyclohexa-1,5-dien-1-yl)-4-methyl-1,2-dihydrotriazole is sourced from PubChem (CID 143610074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).