C8H11FN2 — CID 147857381
3-fluoro-N,5-dimethyl-2-methylidenepyridin-1-amine (PubChem CID 147857381) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-fluoro-N,5-dimethyl-2-methylidenepyridin-1-amine.
| Compound Name | 3-fluoro-N,5-dimethyl-2-methylidenepyridin-1-amine |
|---|---|
| PubChem CID | 147857381 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 3-fluoro-N,5-dimethyl-2-methylidenepyridin-1-amine |
| SMILES | C=C1C(F)=CC(C)=CN1NC |
| InChI | InChI=1S/C8H11FN2/c1-6-4-8(9)7(2)11(5-6)10-3/h4-5,10H,2H2,1,3H3 |
| InChIKey | YRAJPJWERIUUSF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |