About ethane;1-ethenyl-N,3-dimethylpyridin-2-imine
ethane;1-ethenyl-N,3-dimethylpyridin-2-imine (PubChem CID 143611164) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;1-ethenyl-N,3-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | ethane;1-ethenyl-N,3-dimethylpyridin-2-imine |
| PubChem CID | 143611164 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;1-ethenyl-N,3-dimethylpyridin-2-imine |
| SMILES | C=Cn1cccc(C)/c1=N\C.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-4-11-7-5-6-8(2)9(11)10-3;1-2/h4-7H,1H2,2-3H3;1-2H3/b10-9+; |
| InChIKey | NHEQSWMOGLGVBW-RRABGKBLSA-N |
| XLogP | 2.45 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethenyl-N,3-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenyl-N,3-dimethylpyridin-2-imine?
The IUPAC name of ethane;1-ethenyl-N,3-dimethylpyridin-2-imine (CID 143611164) is ethane;1-ethenyl-N,3-dimethylpyridin-2-imine.
What is the SMILES notation for ethane;1-ethenyl-N,3-dimethylpyridin-2-imine?
The canonical SMILES for ethane;1-ethenyl-N,3-dimethylpyridin-2-imine is C=Cn1cccc(C)/c1=N\C.CC.
What is the InChIKey of ethane;1-ethenyl-N,3-dimethylpyridin-2-imine?
The InChIKey is NHEQSWMOGLGVBW-RRABGKBLSA-N. The full InChI is InChI=1S/C9H12N2.C2H6/c1-4-11-7-5-6-8(2)9(11)10-3;1-2/h4-7H,1H2,2-3H3;1-2H3/b10-9+;.
What are the key properties of ethane;1-ethenyl-N,3-dimethylpyridin-2-imine?
ethane;1-ethenyl-N,3-dimethylpyridin-2-imine has a molecular weight of 178.28 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenyl-N,3-dimethylpyridin-2-imine is sourced from PubChem (CID 143611164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).