C22H24N7O3- — CID 143611282
[(Z)-4-imino-4-phenylbut-2-enimidoyl]-[2-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]ethanimidoyl]azanide (PubChem CID 143611282) has the molecular formula C22H24N7O3- and a molecular weight of 434.48 g/mol. Its IUPAC name is [(Z)-4-imino-4-phenylbut-2-enimidoyl]-[2-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]ethanimidoyl]azanide.
| Compound Name | [(Z)-4-imino-4-phenylbut-2-enimidoyl]-[2-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]ethanimidoyl]azanide |
|---|---|
| PubChem CID | 143611282 |
| Molecular Formula | C22H24N7O3- |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | [(Z)-4-imino-4-phenylbut-2-enimidoyl]-[2-[[2-(morpholine-4-carbonylamino)-4-pyridinyl]oxy]ethanimidoyl]azanide |
| SMILES | [H]/N=C(/COc1ccnc(NC(=O)N2CCOCC2)c1)[N-]C(/C=C\C(=N\[H])c1ccccc1)=N/[H] |
| InChI | InChI=1S/C22H25N7O3/c23-18(16-4-2-1-3-5-16)6-7-19(24)27-20(25)15-32-17-8-9-26-21(14-17)28-22(30)29-10-12-31-13-11-29/h1-9,14,23H,10-13,15H2,(H4,24,25,26,27,28,30)/p-1/b7-6-,23-18- |
| InChIKey | VHPRBLDWUBGLEH-PDFUVWIYSA-M |
| XLogP | 3.28 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|