C11H18N2 — CID 143611351
ethane;1-ethenyl-N,6-dimethylpyridin-2-imine (PubChem CID 143611351) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;1-ethenyl-N,6-dimethylpyridin-2-imine.
| Compound Name | ethane;1-ethenyl-N,6-dimethylpyridin-2-imine |
|---|---|
| PubChem CID | 143611351 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;1-ethenyl-N,6-dimethylpyridin-2-imine |
| SMILES | C=Cn1c(C)ccc/c1=N\C.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-4-11-8(2)6-5-7-9(11)10-3;1-2/h4-7H,1H2,2-3H3;1-2H3/b10-9+; |
| InChIKey | HJXUPOWAJQLULT-RRABGKBLSA-N |
| XLogP | 2.45 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |