C41H51N3O5S — CID 143611971
6-cyclohexyl-5-[2-[(1Z)-1-(1-ethoxyethenylimino)-3-methylbut-2-en-2-yl]quinolin-6-yl]-4-(2-methyl-3-oxoprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid;1-propoxypropane (PubChem CID 143611971) has the molecular formula C41H51N3O5S and a molecular weight of 697.94 g/mol. Its IUPAC name is 6-cyclohexyl-5-[2-[(1Z)-1-(1-ethoxyethenylimino)-3-methylbut-2-en-2-yl]quinolin-6-yl]-4-(2-methyl-3-oxoprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid;1-propoxypropane.
| Compound Name | 6-cyclohexyl-5-[2-[(1Z)-1-(1-ethoxyethenylimino)-3-methylbut-2-en-2-yl]quinolin-6-yl]-4-(2-methyl-3-oxoprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid;1-propoxypropane |
|---|---|
| PubChem CID | 143611971 |
| Molecular Formula | C41H51N3O5S |
| Molecular Weight | 697.94 g/mol |
| Exact Mass | 697.35 |
| IUPAC Name | 6-cyclohexyl-5-[2-[(1Z)-1-(1-ethoxyethenylimino)-3-methylbut-2-en-2-yl]quinolin-6-yl]-4-(2-methyl-3-oxoprop-2-enyl)thieno[3,2-b]pyrrole-2-carboxylic acid;1-propoxypropane |
| SMILES | C=C(/N=C\C(=C(C)C)c1ccc2cc(-c3c(C4CCCCC4)c4sc(C(=O)O)cc4n3CC(C)=C=O)ccc2n1)OCC.CCCOCCC |
| InChI | InChI=1S/C35H37N3O4S.C6H14O/c1-6-42-23(5)36-18-27(21(2)3)29-15-12-25-16-26(13-14-28(25)37-29)33-32(24-10-8-7-9-11-24)34-30(17-31(43-34)35(40)41)38(33)19-22(4)20-39;1-3-5-7-6-4-2/h12-18,24H,5-11,19H2,1-4H3,(H,40,41);3-6H2,1-2H3/b36-18-; |
| InChIKey | KXWYWDHYCWXCDC-INONLSSHSA-N |
| XLogP | 10.64 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.94 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|