C33H50N6 — CID 143612992
2-ethyl-1-[5-[7-[(5Z,6Z)-5-ethylidenenona-6,8-dienyl]-2-[hexyl(methyl)amino]-4H-1,3-diazepin-4-yl]cyclohepta-1,4,6-trien-1-yl]guanidine (PubChem CID 143612992) has the molecular formula C33H50N6 and a molecular weight of 530.81 g/mol. Its IUPAC name is 2-ethyl-1-[5-[7-[(5Z,6Z)-5-ethylidenenona-6,8-dienyl]-2-[hexyl(methyl)amino]-4H-1,3-diazepin-4-yl]cyclohepta-1,4,6-trien-1-yl]guanidine.
| Compound Name | 2-ethyl-1-[5-[7-[(5Z,6Z)-5-ethylidenenona-6,8-dienyl]-2-[hexyl(methyl)amino]-4H-1,3-diazepin-4-yl]cyclohepta-1,4,6-trien-1-yl]guanidine |
|---|---|
| PubChem CID | 143612992 |
| Molecular Formula | C33H50N6 |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 530.41 |
| IUPAC Name | 2-ethyl-1-[5-[7-[(5Z,6Z)-5-ethylidenenona-6,8-dienyl]-2-[hexyl(methyl)amino]-4H-1,3-diazepin-4-yl]cyclohepta-1,4,6-trien-1-yl]guanidine |
| SMILES | C=C/C=C\C(=C/C)CCCCC1=NC(N(C)CCCCCC)=NC(C2=CCC=C(N/C(N)=N/CC)C=C2)C=C1 |
| InChI | InChI=1S/C33H50N6/c1-6-10-12-15-26-39(5)33-37-30(20-14-13-18-27(8-3)17-11-7-2)24-25-31(38-33)28-19-16-21-29(23-22-28)36-32(34)35-9-4/h7-8,11,17,19,21-25,31H,2,6,9-10,12-16,18,20,26H2,1,3-5H3,(H3,34,35,36)/b17-11-,27-8+ |
| InChIKey | WJUUNHZUCIENKA-FKHMTROKSA-N |
| XLogP | 7.18 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|