C18H24N4 — CID 143339128
(1E,5Z)-8-(1-aminoethenyl)-5-cyclohepta-1,4-dien-1-yl-N-prop-2-enyl-4,7-dihydro-1,3-diazocin-2-amine (PubChem CID 143339128) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is (1E,5Z)-8-(1-aminoethenyl)-5-cyclohepta-1,4-dien-1-yl-N-prop-2-enyl-4,7-dihydro-1,3-diazocin-2-amine.
| Compound Name | (1E,5Z)-8-(1-aminoethenyl)-5-cyclohepta-1,4-dien-1-yl-N-prop-2-enyl-4,7-dihydro-1,3-diazocin-2-amine |
|---|---|
| PubChem CID | 143339128 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1E,5Z)-8-(1-aminoethenyl)-5-cyclohepta-1,4-dien-1-yl-N-prop-2-enyl-4,7-dihydro-1,3-diazocin-2-amine |
| SMILES | C=CCNC1=N/C/C(C2=CCC=CCC2)=C\C/C(C(=C)N)=N\1 |
| InChI | InChI=1S/C18H24N4/c1-3-12-20-18-21-13-16(10-11-17(22-18)14(2)19)15-8-6-4-5-7-9-15/h3-5,8,10H,1-2,6-7,9,11-13,19H2,(H,20,21)/b16-10+,22-17+ |
| InChIKey | ODHXYBWSJRGHAY-SHHSRAAISA-N |
| XLogP | 3.03 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|