C21H22Cl3N3O3 — CID 143615145
(4R,5R)-4-N-[(4-chlorophenyl)methyl]-3-N-[(2,4-dichlorophenyl)methyl]-4-N,5-dimethyl-1,3-oxazolidine-3,4-dicarboxamide (PubChem CID 143615145) has the molecular formula C21H22Cl3N3O3 and a molecular weight of 470.78 g/mol. Its IUPAC name is (4R,5R)-4-N-[(4-chlorophenyl)methyl]-3-N-[(2,4-dichlorophenyl)methyl]-4-N,5-dimethyl-1,3-oxazolidine-3,4-dicarboxamide.
| Compound Name | (4R,5R)-4-N-[(4-chlorophenyl)methyl]-3-N-[(2,4-dichlorophenyl)methyl]-4-N,5-dimethyl-1,3-oxazolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 143615145 |
| Molecular Formula | C21H22Cl3N3O3 |
| Molecular Weight | 470.78 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | (4R,5R)-4-N-[(4-chlorophenyl)methyl]-3-N-[(2,4-dichlorophenyl)methyl]-4-N,5-dimethyl-1,3-oxazolidine-3,4-dicarboxamide |
| SMILES | C[C@H]1OCN(C(=O)NCc2ccc(Cl)cc2Cl)[C@H]1C(=O)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22Cl3N3O3/c1-13-19(20(28)26(2)11-14-3-6-16(22)7-4-14)27(12-30-13)21(29)25-10-15-5-8-17(23)9-18(15)24/h3-9,13,19H,10-12H2,1-2H3,(H,25,29)/t13-,19-/m1/s1 |
| InChIKey | QVTJAOMTFDHABA-BFUOFWGJSA-N |
| XLogP | 4.56 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |