C16H28N2O — CID 143615637
(4E,6E)-7-methoxy-4-methyl-1-piperidin-1-ylnona-4,6,8-trien-2-amine (PubChem CID 143615637) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (4E,6E)-7-methoxy-4-methyl-1-piperidin-1-ylnona-4,6,8-trien-2-amine.
| Compound Name | (4E,6E)-7-methoxy-4-methyl-1-piperidin-1-ylnona-4,6,8-trien-2-amine |
|---|---|
| PubChem CID | 143615637 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (4E,6E)-7-methoxy-4-methyl-1-piperidin-1-ylnona-4,6,8-trien-2-amine |
| SMILES | C=C/C(=C\C=C(/C)CC(N)CN1CCCCC1)OC |
| InChI | InChI=1S/C16H28N2O/c1-4-16(19-3)9-8-14(2)12-15(17)13-18-10-6-5-7-11-18/h4,8-9,15H,1,5-7,10-13,17H2,2-3H3/b14-8+,16-9+ |
| InChIKey | FGMVSJWDTXSPOX-JTHWEQIXSA-N |
| XLogP | 2.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|