C13H24N2O — CID 142256489
ethane;1-(3-methoxycyclohexa-2,4-dien-1-yl)piperazine (PubChem CID 142256489) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;1-(3-methoxycyclohexa-2,4-dien-1-yl)piperazine.
| Compound Name | ethane;1-(3-methoxycyclohexa-2,4-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 142256489 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;1-(3-methoxycyclohexa-2,4-dien-1-yl)piperazine |
| SMILES | CC.COC1=CC(N2CCNCC2)CC=C1 |
| InChI | InChI=1S/C11H18N2O.C2H6/c1-14-11-4-2-3-10(9-11)13-7-5-12-6-8-13;1-2/h2,4,9-10,12H,3,5-8H2,1H3;1-2H3 |
| InChIKey | BXDMRPDXNOQHET-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |