C10H16N2O — CID 89307926
4-piperazin-1-ylcyclohexa-1,5-dien-1-ol (PubChem CID 89307926) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-piperazin-1-ylcyclohexa-1,5-dien-1-ol.
| Compound Name | 4-piperazin-1-ylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 89307926 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-piperazin-1-ylcyclohexa-1,5-dien-1-ol |
| SMILES | OC1=CCC(N2CCNCC2)C=C1 |
| InChI | InChI=1S/C10H16N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1,3-4,9,11,13H,2,5-8H2 |
| InChIKey | WTBOFBXIYGRCEE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |