C12H24N2O — CID 145255918
ethane;4-[2-(ethylamino)ethylamino]cyclohexa-1,5-dien-1-ol (PubChem CID 145255918) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is ethane;4-[2-(ethylamino)ethylamino]cyclohexa-1,5-dien-1-ol.
| Compound Name | ethane;4-[2-(ethylamino)ethylamino]cyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 145255918 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | ethane;4-[2-(ethylamino)ethylamino]cyclohexa-1,5-dien-1-ol |
| SMILES | CC.CCNCCNC1C=CC(O)=CC1 |
| InChI | InChI=1S/C10H18N2O.C2H6/c1-2-11-7-8-12-9-3-5-10(13)6-4-9;1-2/h3,5-6,9,11-13H,2,4,7-8H2,1H3;1-2H3 |
| InChIKey | AMYPWEBJXCGEPC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|