C33H32N4O3S — CID 143615783
3-cyclohexyl-17-(4-methoxyphenyl)-5-thia-9,18-diazapentacyclo[11.8.0.02,9.04,8.014,19]henicosa-1(13),2,4(8),6,14(19),15,17,20-octaene-6,11-dicarboxamide (PubChem CID 143615783) has the molecular formula C33H32N4O3S and a molecular weight of 564.71 g/mol. Its IUPAC name is 3-cyclohexyl-17-(4-methoxyphenyl)-5-thia-9,18-diazapentacyclo[11.8.0.02,9.04,8.014,19]henicosa-1(13),2,4(8),6,14(19),15,17,20-octaene-6,11-dicarboxamide.
| Compound Name | 3-cyclohexyl-17-(4-methoxyphenyl)-5-thia-9,18-diazapentacyclo[11.8.0.02,9.04,8.014,19]henicosa-1(13),2,4(8),6,14(19),15,17,20-octaene-6,11-dicarboxamide |
|---|---|
| PubChem CID | 143615783 |
| Molecular Formula | C33H32N4O3S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 3-cyclohexyl-17-(4-methoxyphenyl)-5-thia-9,18-diazapentacyclo[11.8.0.02,9.04,8.014,19]henicosa-1(13),2,4(8),6,14(19),15,17,20-octaene-6,11-dicarboxamide |
| SMILES | COc1ccc(-c2ccc3c4c(ccc3n2)-c2c(C3CCCCC3)c3sc(C(N)=O)cc3n2CC(C(N)=O)C4)cc1 |
| InChI | InChI=1S/C33H32N4O3S/c1-40-21-9-7-18(8-10-21)25-13-11-22-24-15-20(32(34)38)17-37-27-16-28(33(35)39)41-31(27)29(19-5-3-2-4-6-19)30(37)23(24)12-14-26(22)36-25/h7-14,16,19-20H,2-6,15,17H2,1H3,(H2,34,38)(H2,35,39) |
| InChIKey | SICMMLJMTGCRPU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |