C33H42N4O3 — CID 143589976
13-cyclohexyl-3-methoxy-6-[(3S,5R)-3,4,5-trimethylpiperazine-1-carbonyl]-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxamide (PubChem CID 143589976) has the molecular formula C33H42N4O3 and a molecular weight of 542.72 g/mol. Its IUPAC name is 13-cyclohexyl-3-methoxy-6-[(3S,5R)-3,4,5-trimethylpiperazine-1-carbonyl]-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxamide.
| Compound Name | 13-cyclohexyl-3-methoxy-6-[(3S,5R)-3,4,5-trimethylpiperazine-1-carbonyl]-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxamide |
|---|---|
| PubChem CID | 143589976 |
| Molecular Formula | C33H42N4O3 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 13-cyclohexyl-3-methoxy-6-[(3S,5R)-3,4,5-trimethylpiperazine-1-carbonyl]-6,7-dihydro-5H-indolo[2,1-a][2]benzazepine-10-carboxamide |
| SMILES | COc1ccc2c(c1)CC(C(=O)N1C[C@@H](C)N(C)[C@@H](C)C1)Cn1c-2c(C2CCCCC2)c2ccc(C(N)=O)cc21 |
| InChI | InChI=1S/C33H42N4O3/c1-20-17-36(18-21(2)35(20)3)33(39)25-14-24-15-26(40-4)11-13-27(24)31-30(22-8-6-5-7-9-22)28-12-10-23(32(34)38)16-29(28)37(31)19-25/h10-13,15-16,20-22,25H,5-9,14,17-19H2,1-4H3,(H2,34,38)/t20-,21+,25? |
| InChIKey | RJSBRCXBDXYPRG-KEVCNVLYSA-N |
| XLogP | 5.19 |
| TPSA | 80.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |