C34H42N2O3 — CID 143427372
N-(10-but-1-en-2-yl-13-cyclohexyl-3-methoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepin-6-yl)oxane-4-carboxamide (PubChem CID 143427372) has the molecular formula C34H42N2O3 and a molecular weight of 526.72 g/mol. Its IUPAC name is N-(10-but-1-en-2-yl-13-cyclohexyl-3-methoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepin-6-yl)oxane-4-carboxamide.
| Compound Name | N-(10-but-1-en-2-yl-13-cyclohexyl-3-methoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepin-6-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 143427372 |
| Molecular Formula | C34H42N2O3 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | N-(10-but-1-en-2-yl-13-cyclohexyl-3-methoxy-6,7-dihydro-5H-indolo[2,1-a][2]benzazepin-6-yl)oxane-4-carboxamide |
| SMILES | C=C(CC)c1ccc2c(C3CCCCC3)c3n(c2c1)CC(NC(=O)C1CCOCC1)Cc1cc(OC)ccc1-3 |
| InChI | InChI=1S/C34H42N2O3/c1-4-22(2)25-10-12-30-31(20-25)36-21-27(35-34(37)24-14-16-39-17-15-24)18-26-19-28(38-3)11-13-29(26)33(36)32(30)23-8-6-5-7-9-23/h10-13,19-20,23-24,27H,2,4-9,14-18,21H2,1,3H3,(H,35,37) |
| InChIKey | HKGUFSODYYSUOV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|