C25H28N2O3 — CID 126714436
11-cyclohexyl-6-ethoxy-8-methoxy-6H-isoindolo[2,1-a]indole-3-carboxamide (PubChem CID 126714436) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 11-cyclohexyl-6-ethoxy-8-methoxy-6H-isoindolo[2,1-a]indole-3-carboxamide.
| Compound Name | 11-cyclohexyl-6-ethoxy-8-methoxy-6H-isoindolo[2,1-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 126714436 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 11-cyclohexyl-6-ethoxy-8-methoxy-6H-isoindolo[2,1-a]indole-3-carboxamide |
| SMILES | CCOC1c2cc(OC)ccc2-c2c(C3CCCCC3)c3ccc(C(N)=O)cc3n21 |
| InChI | InChI=1S/C25H28N2O3/c1-3-30-25-20-14-17(29-2)10-12-18(20)23-22(15-7-5-4-6-8-15)19-11-9-16(24(26)28)13-21(19)27(23)25/h9-15,25H,3-8H2,1-2H3,(H2,26,28) |
| InChIKey | GKPMVDGTRVYSOH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |