C33H42N4O4 — CID 143870056
2-[2-(1-acetylpyrrolidin-3-yl)-4-methoxyphenyl]-3-cyclohexyl-1-[3-(dimethylamino)-3-oxopropyl]indole-6-carboxamide (PubChem CID 143870056) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 2-[2-(1-acetylpyrrolidin-3-yl)-4-methoxyphenyl]-3-cyclohexyl-1-[3-(dimethylamino)-3-oxopropyl]indole-6-carboxamide.
| Compound Name | 2-[2-(1-acetylpyrrolidin-3-yl)-4-methoxyphenyl]-3-cyclohexyl-1-[3-(dimethylamino)-3-oxopropyl]indole-6-carboxamide |
|---|---|
| PubChem CID | 143870056 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 2-[2-(1-acetylpyrrolidin-3-yl)-4-methoxyphenyl]-3-cyclohexyl-1-[3-(dimethylamino)-3-oxopropyl]indole-6-carboxamide |
| SMILES | COc1ccc(-c2c(C3CCCCC3)c3ccc(C(N)=O)cc3n2CCC(=O)N(C)C)c(C2CCN(C(C)=O)C2)c1 |
| InChI | InChI=1S/C33H42N4O4/c1-21(38)36-16-14-24(20-36)28-19-25(41-4)11-13-26(28)32-31(22-8-6-5-7-9-22)27-12-10-23(33(34)40)18-29(27)37(32)17-15-30(39)35(2)3/h10-13,18-19,22,24H,5-9,14-17,20H2,1-4H3,(H2,34,40) |
| InChIKey | GPSDTLZASFCYAA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 97.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|