C10H8Cl2N2O3 — CID 143616065
2-(6,7-dichloro-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 143616065) has the molecular formula C10H8Cl2N2O3 and a molecular weight of 275.09 g/mol. Its IUPAC name is 2-(6,7-dichloro-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | 2-(6,7-dichloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 143616065 |
| Molecular Formula | C10H8Cl2N2O3 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2-(6,7-dichloro-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)COc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C10H8Cl2N2O3/c11-5-1-7-8(2-6(5)12)17-4-10(16)14(7)3-9(13)15/h1-2H,3-4H2,(H2,13,15) |
| InChIKey | BEQLGISVISESRG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |