C15H26O4 — CID 143616397
(2-methyl-1,3-dioxolan-4-yl)methyl dec-9-enoate (PubChem CID 143616397) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2-methyl-1,3-dioxolan-4-yl)methyl dec-9-enoate.
| Compound Name | (2-methyl-1,3-dioxolan-4-yl)methyl dec-9-enoate |
|---|---|
| PubChem CID | 143616397 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (2-methyl-1,3-dioxolan-4-yl)methyl dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)OCC1COC(C)O1 |
| InChI | InChI=1S/C15H26O4/c1-3-4-5-6-7-8-9-10-15(16)18-12-14-11-17-13(2)19-14/h3,13-14H,1,4-12H2,2H3 |
| InChIKey | QNTIXBXNDCJBIW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|