C28H46ClN3O3S2 — CID 143616548
[2-[4-(3-chloropropoxy)phenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-methylidene-morpholin-4-yl-oxo-λ6-sulfane;ethane;hexane (PubChem CID 143616548) has the molecular formula C28H46ClN3O3S2 and a molecular weight of 572.28 g/mol. Its IUPAC name is [2-[4-(3-chloropropoxy)phenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-methylidene-morpholin-4-yl-oxo-λ6-sulfane;ethane;hexane.
| Compound Name | [2-[4-(3-chloropropoxy)phenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-methylidene-morpholin-4-yl-oxo-λ6-sulfane;ethane;hexane |
|---|---|
| PubChem CID | 143616548 |
| Molecular Formula | C28H46ClN3O3S2 |
| Molecular Weight | 572.28 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | [2-[4-(3-chloropropoxy)phenyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]-methylidene-morpholin-4-yl-oxo-λ6-sulfane;ethane;hexane |
| SMILES | C=S(=O)(N1CCOCC1)N1CCc2nc(-c3ccc(OCCCCl)cc3)sc2C1.CC.CCCCCC |
| InChI | InChI=1S/C20H26ClN3O3S2.C6H14.C2H6/c1-29(25,23-10-13-26-14-11-23)24-9-7-18-19(15-24)28-20(22-18)16-3-5-17(6-4-16)27-12-2-8-21;1-3-5-6-4-2;1-2/h3-6H,1-2,7-15H2;3-6H2,1-2H3;1-2H3 |
| InChIKey | TVBJHHLZBHIZNA-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.28 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|