C11H19NO — CID 143617273
ethane;(5E)-5-ethylidene-1,2-dimethyl-2H-pyridin-6-one (PubChem CID 143617273) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is ethane;(5E)-5-ethylidene-1,2-dimethyl-2H-pyridin-6-one.
| Compound Name | ethane;(5E)-5-ethylidene-1,2-dimethyl-2H-pyridin-6-one |
|---|---|
| PubChem CID | 143617273 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | ethane;(5E)-5-ethylidene-1,2-dimethyl-2H-pyridin-6-one |
| SMILES | C/C=C1\C=CC(C)N(C)C1=O.CC |
| InChI | InChI=1S/C9H13NO.C2H6/c1-4-8-6-5-7(2)10(3)9(8)11;1-2/h4-7H,1-3H3;1-2H3/b8-4+; |
| InChIKey | NVBVKCRSIVJQHA-ZFXMFRGYSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|