C7H10N2 — CID 143618670
1,5-dimethyl-3-methylidenepyrrol-2-imine (PubChem CID 143618670) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 1,5-dimethyl-3-methylidenepyrrol-2-imine.
| Compound Name | 1,5-dimethyl-3-methylidenepyrrol-2-imine |
|---|---|
| PubChem CID | 143618670 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1,5-dimethyl-3-methylidenepyrrol-2-imine |
| SMILES | [H]/N=C1\C(=C)C=C(C)N1C |
| InChI | InChI=1S/C7H10N2/c1-5-4-6(2)9(3)7(5)8/h4,8H,1H2,2-3H3/b8-7+ |
| InChIKey | MOBTZAOOQPZPRT-BQYQJAHWSA-N |
| XLogP | 1.37 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|