C11H9N3OS — CID 143620068
2-(3H-benzimidazol-5-yl)-5-methylsulfanyl-1,3-oxazole (PubChem CID 143620068) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-(3H-benzimidazol-5-yl)-5-methylsulfanyl-1,3-oxazole.
| Compound Name | 2-(3H-benzimidazol-5-yl)-5-methylsulfanyl-1,3-oxazole |
|---|---|
| PubChem CID | 143620068 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-(3H-benzimidazol-5-yl)-5-methylsulfanyl-1,3-oxazole |
| SMILES | CSc1cnc(-c2ccc3nc[nH]c3c2)o1 |
| InChI | InChI=1S/C11H9N3OS/c1-16-10-5-12-11(15-10)7-2-3-8-9(4-7)14-6-13-8/h2-6H,1H3,(H,13,14) |
| InChIKey | UMYIPTCAKADANO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |