C12H10N4OS — CID 25024286
2-(3H-benzimidazol-5-yl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole (PubChem CID 25024286) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-(3H-benzimidazol-5-yl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(3H-benzimidazol-5-yl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 25024286 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-(3H-benzimidazol-5-yl)-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=CCSc1nnc(-c2ccc3nc[nH]c3c2)o1 |
| InChI | InChI=1S/C12H10N4OS/c1-2-5-18-12-16-15-11(17-12)8-3-4-9-10(6-8)14-7-13-9/h2-4,6-7H,1,5H2,(H,13,14) |
| InChIKey | XVIDYGSAQLUXTC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|