C11H11N5O2S — CID 146414389
2-[[5-(3H-benzimidazol-5-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethane-1,1-diol (PubChem CID 146414389) has the molecular formula C11H11N5O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[[5-(3H-benzimidazol-5-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethane-1,1-diol.
| Compound Name | 2-[[5-(3H-benzimidazol-5-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 146414389 |
| Molecular Formula | C11H11N5O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2-[[5-(3H-benzimidazol-5-yl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethane-1,1-diol |
| SMILES | OC(O)CSc1n[nH]c(-c2ccc3nc[nH]c3c2)n1 |
| InChI | InChI=1S/C11H11N5O2S/c17-9(18)4-19-11-14-10(15-16-11)6-1-2-7-8(3-6)13-5-12-7/h1-3,5,9,17-18H,4H2,(H,12,13)(H,14,15,16) |
| InChIKey | JMEJMWOBPPMWFO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 110.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|