C7H11FNP — CID 143620785
(1E,2Z)-3-methyl-N-(phosphanylmethyl)penta-2,4-dienimidoyl fluoride (PubChem CID 143620785) has the molecular formula C7H11FNP and a molecular weight of 159.14 g/mol. Its IUPAC name is (1E,2Z)-3-methyl-N-(phosphanylmethyl)penta-2,4-dienimidoyl fluoride.
| Compound Name | (1E,2Z)-3-methyl-N-(phosphanylmethyl)penta-2,4-dienimidoyl fluoride |
|---|---|
| PubChem CID | 143620785 |
| Molecular Formula | C7H11FNP |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (1E,2Z)-3-methyl-N-(phosphanylmethyl)penta-2,4-dienimidoyl fluoride |
| SMILES | C=C/C(C)=C\C(F)=N/CP |
| InChI | InChI=1S/C7H11FNP/c1-3-6(2)4-7(8)9-5-10/h3-4H,1,5,10H2,2H3/b6-4-,9-7+ |
| InChIKey | KXLNNGSOHDTPOU-UNQQQNFISA-N |
| XLogP | 2.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|