C18H33NO — CID 143622351
N-methyl-1-(3-methyl-4-propylphenyl)propan-2-amine;2-methylpropan-2-ol (PubChem CID 143622351) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-4-propylphenyl)propan-2-amine;2-methylpropan-2-ol.
| Compound Name | N-methyl-1-(3-methyl-4-propylphenyl)propan-2-amine;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 143622351 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | N-methyl-1-(3-methyl-4-propylphenyl)propan-2-amine;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCCc1ccc(CC(C)NC)cc1C |
| InChI | InChI=1S/C14H23N.C4H10O/c1-5-6-14-8-7-13(9-11(14)2)10-12(3)15-4;1-4(2,3)5/h7-9,12,15H,5-6,10H2,1-4H3;5H,1-3H3 |
| InChIKey | VSWYLQJJIFRESH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |