C31H42ClFN4O2 — CID 143622689
4-[1-[4-[(3-chloro-4-fluorobenzoyl)amino]piperidin-1-yl]ethyl]-3-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide (PubChem CID 143622689) has the molecular formula C31H42ClFN4O2 and a molecular weight of 557.15 g/mol. Its IUPAC name is 4-[1-[4-[(3-chloro-4-fluorobenzoyl)amino]piperidin-1-yl]ethyl]-3-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 4-[1-[4-[(3-chloro-4-fluorobenzoyl)amino]piperidin-1-yl]ethyl]-3-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 143622689 |
| Molecular Formula | C31H42ClFN4O2 |
| Molecular Weight | 557.15 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 4-[1-[4-[(3-chloro-4-fluorobenzoyl)amino]piperidin-1-yl]ethyl]-3-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]benzamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCCCC2C)ccc1C(C)N1CCC(NC(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C31H42ClFN4O2/c1-21-19-24(30(38)34-14-6-16-36-15-5-4-7-22(36)2)8-10-27(21)23(3)37-17-12-26(13-18-37)35-31(39)25-9-11-29(33)28(32)20-25/h8-11,19-20,22-23,26H,4-7,12-18H2,1-3H3,(H,34,38)(H,35,39) |
| InChIKey | OLWPTKLQQYRHMI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.15 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|