C26H35FN2O3 — CID 143622790
2-(3-fluorophenyl)-N-[1-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperidin-4-yl]acetamide (PubChem CID 143622790) has the molecular formula C26H35FN2O3 and a molecular weight of 442.58 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[1-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[1-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 143622790 |
| Molecular Formula | C26H35FN2O3 |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[1-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]piperidin-4-yl]acetamide |
| SMILES | COCCOc1ccc(C(C)N2CCC(NC(=O)Cc3cccc(F)c3)CC2)c(C)c1C |
| InChI | InChI=1S/C26H35FN2O3/c1-18-19(2)25(32-15-14-31-4)9-8-24(18)20(3)29-12-10-23(11-13-29)28-26(30)17-21-6-5-7-22(27)16-21/h5-9,16,20,23H,10-15,17H2,1-4H3,(H,28,30) |
| InChIKey | TUGSFUHKTYLFNU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|