About ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate
ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 143624386) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 143624386 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | CC.CNC.[H]/N=C(\OC)C1C=CC(C(=O)OC)=CC1 |
| InChI | InChI=1S/C10H13NO3.C2H7N.C2H6/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;1-3-2;1-2/h3,5-7,11H,4H2,1-2H3;3H,1-2H3;1-2H3/b11-9-;; |
| InChIKey | MVEBZPMLWYRTBY-WSELPHFCSA-N |
| XLogP | 2.15 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate (CID 143624386) is ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate is CC.CNC.[H]/N=C(\OC)C1C=CC(C(=O)OC)=CC1.
What is the InChIKey of ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is MVEBZPMLWYRTBY-WSELPHFCSA-N. The full InChI is InChI=1S/C10H13NO3.C2H7N.C2H6/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;1-3-2;1-2/h3,5-7,11H,4H2,1-2H3;3H,1-2H3;1-2H3/b11-9-;;.
What are the key properties of ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate?
ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methylmethanamine;methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 143624386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).