C10H13NO3 — CID 143624387
methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 143624387) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 143624387 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | methyl 4-(C-methoxycarbonimidoyl)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | [H]/N=C(\OC)C1C=CC(C(=O)OC)=CC1 |
| InChI | InChI=1S/C10H13NO3/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h3,5-7,11H,4H2,1-2H3/b11-9- |
| InChIKey | AQIBXULBIWBYJG-LUAWRHEFSA-N |
| XLogP | 1.29 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|