C9H10N2O2 — CID 155698761
methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 155698761) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 155698761 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | methyl 3,4-diimino-6-methylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | [H]/N=C1\C=C(C)C(C(=O)OC)=C\C1=N/[H] |
| InChI | InChI=1S/C9H10N2O2/c1-5-3-7(10)8(11)4-6(5)9(12)13-2/h3-4,10-11H,1-2H3/b10-7+,11-8+ |
| InChIKey | RRKXUSRNOAPJKV-AMMQDNIMSA-N |
| XLogP | 1.09 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|