C8H8NO2+ — CID 100954696
methyl 4-iminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 100954696) has the molecular formula C8H8NO2+ and a molecular weight of 150.16 g/mol. Its IUPAC name is methyl 4-iminocyclohexa-1,5-diene-1-carboxylate.
| Compound Name | methyl 4-iminocyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 100954696 |
| Molecular Formula | C8H8NO2+ |
| Molecular Weight | 150.16 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | methyl 4-iminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | [H]/N=C1\C=CC(C(=O)OC)=C[CH+]1 |
| InChI | InChI=1S/C8H8NO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5,9H,1H3/q+1 |
| InChIKey | NPGTYKBDNSCLKQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|