C8H7NO2 — CID 101133418
(4-methoxycarbonylcyclohexa-2,4-dien-1-ylidene)azanide (PubChem CID 101133418) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is (4-methoxycarbonylcyclohexa-2,4-dien-1-ylidene)azanide.
| Compound Name | (4-methoxycarbonylcyclohexa-2,4-dien-1-ylidene)azanide |
|---|---|
| PubChem CID | 101133418 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (4-methoxycarbonylcyclohexa-2,4-dien-1-ylidene)azanide |
| SMILES | COC(=O)C1=C[CH+]C(=[N-])C=C1 |
| InChI | InChI=1S/C8H7NO2/c1-11-8(10)6-2-4-7(9)5-3-6/h2-5H,1H3 |
| InChIKey | WVSUZWOJDQUPBD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 48.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|