C20H20ClF3N2O4 — CID 143625956
methyl 2-[acetyl(propan-2-yl)amino]-5-[[5-(chloromethyl)-3-(trifluoromethyl)-2-pyridinyl]oxy]benzoate (PubChem CID 143625956) has the molecular formula C20H20ClF3N2O4 and a molecular weight of 444.84 g/mol. Its IUPAC name is methyl 2-[acetyl(propan-2-yl)amino]-5-[[5-(chloromethyl)-3-(trifluoromethyl)-2-pyridinyl]oxy]benzoate.
| Compound Name | methyl 2-[acetyl(propan-2-yl)amino]-5-[[5-(chloromethyl)-3-(trifluoromethyl)-2-pyridinyl]oxy]benzoate |
|---|---|
| PubChem CID | 143625956 |
| Molecular Formula | C20H20ClF3N2O4 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | methyl 2-[acetyl(propan-2-yl)amino]-5-[[5-(chloromethyl)-3-(trifluoromethyl)-2-pyridinyl]oxy]benzoate |
| SMILES | COC(=O)c1cc(Oc2ncc(CCl)cc2C(F)(F)F)ccc1N(C(C)=O)C(C)C |
| InChI | InChI=1S/C20H20ClF3N2O4/c1-11(2)26(12(3)27)17-6-5-14(8-15(17)19(28)29-4)30-18-16(20(22,23)24)7-13(9-21)10-25-18/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | SCIXPKSSSKLJLQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|