C14H11ClF3N4O3- — CID 59665164
amino-[N-chloro-2-methoxycarbonyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]anilino]azanide (PubChem CID 59665164) has the molecular formula C14H11ClF3N4O3- and a molecular weight of 375.71 g/mol. Its IUPAC name is amino-[N-chloro-2-methoxycarbonyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]anilino]azanide.
| Compound Name | amino-[N-chloro-2-methoxycarbonyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]anilino]azanide |
|---|---|
| PubChem CID | 59665164 |
| Molecular Formula | C14H11ClF3N4O3- |
| Molecular Weight | 375.71 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | amino-[N-chloro-2-methoxycarbonyl-4-[[3-(trifluoromethyl)-2-pyridinyl]oxy]anilino]azanide |
| SMILES | COC(=O)c1cc(Oc2ncccc2C(F)(F)F)ccc1N(Cl)[N-]N |
| InChI | InChI=1S/C14H11ClF3N4O3/c1-24-13(23)9-7-8(4-5-11(9)22(15)21-19)25-12-10(14(16,17)18)3-2-6-20-12/h2-7H,19H2,1H3/q-1 |
| InChIKey | NSQXBIXDQAJYAR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|