C17H17F3N2O4 — CID 143819371
2-[2-methoxyethyl(methyl)amino]-5-[[3-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid (PubChem CID 143819371) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is 2-[2-methoxyethyl(methyl)amino]-5-[[3-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid.
| Compound Name | 2-[2-methoxyethyl(methyl)amino]-5-[[3-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid |
|---|---|
| PubChem CID | 143819371 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[2-methoxyethyl(methyl)amino]-5-[[3-(trifluoromethyl)-2-pyridinyl]oxy]benzoic acid |
| SMILES | COCCN(C)c1ccc(Oc2ncccc2C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C17H17F3N2O4/c1-22(8-9-25-2)14-6-5-11(10-12(14)16(23)24)26-15-13(17(18,19)20)4-3-7-21-15/h3-7,10H,8-9H2,1-2H3,(H,23,24) |
| InChIKey | GLFGLJDHSARZFC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |