C22H26 — CID 143626102
5-(4-phenylhept-1-en-2-yl)-2,3-dihydro-1H-indene (PubChem CID 143626102) has the molecular formula C22H26 and a molecular weight of 290.45 g/mol. Its IUPAC name is 5-(4-phenylhept-1-en-2-yl)-2,3-dihydro-1H-indene.
| Compound Name | 5-(4-phenylhept-1-en-2-yl)-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 143626102 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 5-(4-phenylhept-1-en-2-yl)-2,3-dihydro-1H-indene |
| SMILES | C=C(CC(CCC)c1ccccc1)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H26/c1-3-8-21(18-9-5-4-6-10-18)15-17(2)20-14-13-19-11-7-12-22(19)16-20/h4-6,9-10,13-14,16,21H,2-3,7-8,11-12,15H2,1H3 |
| InChIKey | KKUDAULXLNHBQQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |