C24H29N3O5S — CID 143626478
[3-cyano-2-[[(5E)-6-methoxy-4-methylideneocta-5,7-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] morpholine-4-carboxylate (PubChem CID 143626478) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is [3-cyano-2-[[(5E)-6-methoxy-4-methylideneocta-5,7-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] morpholine-4-carboxylate.
| Compound Name | [3-cyano-2-[[(5E)-6-methoxy-4-methylideneocta-5,7-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 143626478 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [3-cyano-2-[[(5E)-6-methoxy-4-methylideneocta-5,7-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl] morpholine-4-carboxylate |
| SMILES | C=C/C(=C\C(=C)CCC(=O)Nc1sc2c(c1C#N)CCC(OC(=O)N1CCOCC1)C2)OC |
| InChI | InChI=1S/C24H29N3O5S/c1-4-17(30-3)13-16(2)5-8-22(28)26-23-20(15-25)19-7-6-18(14-21(19)33-23)32-24(29)27-9-11-31-12-10-27/h4,13,18H,1-2,5-12,14H2,3H3,(H,26,28)/b17-13+ |
| InChIKey | GVFFGSCIWSWBSA-GHRIWEEISA-N |
| XLogP | 3.94 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|