C26H30N4O4S2 — CID 143626499
[3-cyano-2-[[(4Z)-4-(1-ethoxyethenyl)hepta-4,6-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-(1,3-thiazol-2-ylmethyl)carbamate (PubChem CID 143626499) has the molecular formula C26H30N4O4S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is [3-cyano-2-[[(4Z)-4-(1-ethoxyethenyl)hepta-4,6-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-(1,3-thiazol-2-ylmethyl)carbamate.
| Compound Name | [3-cyano-2-[[(4Z)-4-(1-ethoxyethenyl)hepta-4,6-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-(1,3-thiazol-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 143626499 |
| Molecular Formula | C26H30N4O4S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | [3-cyano-2-[[(4Z)-4-(1-ethoxyethenyl)hepta-4,6-dienoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]methyl N-(1,3-thiazol-2-ylmethyl)carbamate |
| SMILES | C=C/C=C(/CCC(=O)Nc1sc2c(c1C#N)CCC(COC(=O)NCc1nccs1)C2)C(=C)OCC |
| InChI | InChI=1S/C26H30N4O4S2/c1-4-6-19(17(3)33-5-2)8-10-23(31)30-25-21(14-27)20-9-7-18(13-22(20)36-25)16-34-26(32)29-15-24-28-11-12-35-24/h4,6,11-12,18H,1,3,5,7-10,13,15-16H2,2H3,(H,29,32)(H,30,31)/b19-6- |
| InChIKey | BPXYQYYXAMCHLR-SWNXQHNESA-N |
| XLogP | 5.49 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|