C26H32O4 — CID 143627491
1-phenylbut-3-enyl 2-(4-methoxy-2-oxohexyl)-3,4-dimethylbenzoate (PubChem CID 143627491) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is 1-phenylbut-3-enyl 2-(4-methoxy-2-oxohexyl)-3,4-dimethylbenzoate.
| Compound Name | 1-phenylbut-3-enyl 2-(4-methoxy-2-oxohexyl)-3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 143627491 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-phenylbut-3-enyl 2-(4-methoxy-2-oxohexyl)-3,4-dimethylbenzoate |
| SMILES | C=CCC(OC(=O)c1ccc(C)c(C)c1CC(=O)CC(CC)OC)c1ccccc1 |
| InChI | InChI=1S/C26H32O4/c1-6-11-25(20-12-9-8-10-13-20)30-26(28)23-15-14-18(3)19(4)24(23)17-21(27)16-22(7-2)29-5/h6,8-10,12-15,22,25H,1,7,11,16-17H2,2-5H3 |
| InChIKey | ZLSZHHWCHNXJRF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|