C11H15F4NO3 — CID 143628213
1-amino-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-dien-1-yl]oxypropan-2-ol (PubChem CID 143628213) has the molecular formula C11H15F4NO3 and a molecular weight of 285.24 g/mol. Its IUPAC name is 1-amino-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-dien-1-yl]oxypropan-2-ol.
| Compound Name | 1-amino-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-dien-1-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 143628213 |
| Molecular Formula | C11H15F4NO3 |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-amino-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,3-dien-1-yl]oxypropan-2-ol |
| SMILES | NCC(O)COC1=CC(OC(F)(F)C(F)F)=CCC1 |
| InChI | InChI=1S/C11H15F4NO3/c12-10(13)11(14,15)19-9-3-1-2-8(4-9)18-6-7(17)5-16/h3-4,7,10,17H,1-2,5-6,16H2 |
| InChIKey | OTPJBHPHSSBSAB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|