C9H15NO2 — CID 143583056
1-amino-3-cyclohexa-1,5-dien-1-yloxypropan-2-ol (PubChem CID 143583056) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-amino-3-cyclohexa-1,5-dien-1-yloxypropan-2-ol.
| Compound Name | 1-amino-3-cyclohexa-1,5-dien-1-yloxypropan-2-ol |
|---|---|
| PubChem CID | 143583056 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-amino-3-cyclohexa-1,5-dien-1-yloxypropan-2-ol |
| SMILES | NCC(O)COC1=CCCC=C1 |
| InChI | InChI=1S/C9H15NO2/c10-6-8(11)7-12-9-4-2-1-3-5-9/h2,4-5,8,11H,1,3,6-7,10H2 |
| InChIKey | SYCWLHUHDSHXBQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |