C8H15NO2 — CID 123651859
1-amino-3-penta-1,3-dien-3-yloxypropan-2-ol (PubChem CID 123651859) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 1-amino-3-penta-1,3-dien-3-yloxypropan-2-ol.
| Compound Name | 1-amino-3-penta-1,3-dien-3-yloxypropan-2-ol |
|---|---|
| PubChem CID | 123651859 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 1-amino-3-penta-1,3-dien-3-yloxypropan-2-ol |
| SMILES | C=CC(=CC)OCC(O)CN |
| InChI | InChI=1S/C8H15NO2/c1-3-8(4-2)11-6-7(10)5-9/h3-4,7,10H,1,5-6,9H2,2H3 |
| InChIKey | MRLMDUJQDKVFLE-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|