C7H13NO2 — CID 126636690
1-amino-3-buta-1,3-dien-2-yloxypropan-2-ol (PubChem CID 126636690) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-amino-3-buta-1,3-dien-2-yloxypropan-2-ol.
| Compound Name | 1-amino-3-buta-1,3-dien-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 126636690 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 1-amino-3-buta-1,3-dien-2-yloxypropan-2-ol |
| SMILES | C=CC(=C)OCC(O)CN |
| InChI | InChI=1S/C7H13NO2/c1-3-6(2)10-5-7(9)4-8/h3,7,9H,1-2,4-5,8H2 |
| InChIKey | RSPAYCSSWWWDOC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|