C10H15NO2 — CID 142975018
[5-[(1Z)-buta-1,3-dienyl]-6-methyl-2,3-dihydro-1,4-dioxin-2-yl]methanamine (PubChem CID 142975018) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is [5-[(1Z)-buta-1,3-dienyl]-6-methyl-2,3-dihydro-1,4-dioxin-2-yl]methanamine.
| Compound Name | [5-[(1Z)-buta-1,3-dienyl]-6-methyl-2,3-dihydro-1,4-dioxin-2-yl]methanamine |
|---|---|
| PubChem CID | 142975018 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | [5-[(1Z)-buta-1,3-dienyl]-6-methyl-2,3-dihydro-1,4-dioxin-2-yl]methanamine |
| SMILES | C=C/C=C\C1=C(C)OC(CN)CO1 |
| InChI | InChI=1S/C10H15NO2/c1-3-4-5-10-8(2)13-9(6-11)7-12-10/h3-5,9H,1,6-7,11H2,2H3/b5-4- |
| InChIKey | XYAPAZAGQMJVRK-PLNGDYQASA-N |
| XLogP | 1.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|