C9H13NS — CID 143634493
(2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienethioamide (PubChem CID 143634493) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienethioamide.
| Compound Name | (2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienethioamide |
|---|---|
| PubChem CID | 143634493 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (2E)-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienethioamide |
| SMILES | C=C/C=C(\C=C/C)C(=S)NC |
| InChI | InChI=1S/C9H13NS/c1-4-6-8(7-5-2)9(11)10-3/h4-7H,1H2,2-3H3,(H,10,11)/b7-5-,8-6+ |
| InChIKey | WLNBJIFRDIORKI-CGXWXWIYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|