C24H42 — CID 143637890
1-[(1R,3S)-3-cyclohexylcyclopentyl]-4-(3-methylhex-5-enyl)cyclohexane (PubChem CID 143637890) has the molecular formula C24H42 and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-[(1R,3S)-3-cyclohexylcyclopentyl]-4-(3-methylhex-5-enyl)cyclohexane.
| Compound Name | 1-[(1R,3S)-3-cyclohexylcyclopentyl]-4-(3-methylhex-5-enyl)cyclohexane |
|---|---|
| PubChem CID | 143637890 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1-[(1R,3S)-3-cyclohexylcyclopentyl]-4-(3-methylhex-5-enyl)cyclohexane |
| SMILES | C=CCC(C)CCC1CCC([C@@H]2CC[C@H](C3CCCCC3)C2)CC1 |
| InChI | InChI=1S/C24H42/c1-3-7-19(2)10-11-20-12-14-22(15-13-20)24-17-16-23(18-24)21-8-5-4-6-9-21/h3,19-24H,1,4-18H2,2H3/t19?,20?,22?,23-,24+/m0/s1 |
| InChIKey | UPNFEYMZXHETOO-PNBYJGHHSA-N |
| XLogP | 7.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|