C28H46N4 — CID 143637935
N'-[2-[4-[4-(2-methylphenyl)butyl]piperazin-1-yl]ethyl]ethane-1,2-diamine;1,2,4-trimethylbenzene (PubChem CID 143637935) has the molecular formula C28H46N4 and a molecular weight of 438.70 g/mol. Its IUPAC name is N'-[2-[4-[4-(2-methylphenyl)butyl]piperazin-1-yl]ethyl]ethane-1,2-diamine;1,2,4-trimethylbenzene.
| Compound Name | N'-[2-[4-[4-(2-methylphenyl)butyl]piperazin-1-yl]ethyl]ethane-1,2-diamine;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143637935 |
| Molecular Formula | C28H46N4 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | N'-[2-[4-[4-(2-methylphenyl)butyl]piperazin-1-yl]ethyl]ethane-1,2-diamine;1,2,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1.Cc1ccccc1CCCCN1CCN(CCNCCN)CC1 |
| InChI | InChI=1S/C19H34N4.C9H12/c1-18-6-2-3-7-19(18)8-4-5-12-22-14-16-23(17-15-22)13-11-21-10-9-20;1-7-4-5-8(2)9(3)6-7/h2-3,6-7,21H,4-5,8-17,20H2,1H3;4-6H,1-3H3 |
| InChIKey | GOVFEHXDRDPQMX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|